C48H62N4O8 — CID 67295171
bis((3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine);2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid (PubChem CID 67295171) has the molecular formula C48H62N4O8 and a molecular weight of 823.04 g/mol. Its IUPAC name is bis((3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine);2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid.
| Compound Name | bis((3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine);2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
|---|---|
| PubChem CID | 67295171 |
| Molecular Formula | C48H62N4O8 |
| Molecular Weight | 823.04 g/mol |
| Exact Mass | 822.46 |
| IUPAC Name | bis((3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine);2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid |
| SMILES | CN[C@H]1CN(Cc2ccccc2)CC[C@H]1C.CN[C@H]1CN(Cc2ccccc2)CC[C@H]1C.Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8.2C14H22N2/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;2*1-12-8-9-16(11-14(12)15-2)10-13-6-4-3-5-7-13/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);2*3-7,12,14-15H,8-11H2,1-2H3/t;2*12-,14+/m.11/s1 |
| InChIKey | HTAHPXQCMAXJLS-HWKXCMHYSA-N |
| XLogP | 5.23 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|