C25H27F2N3O3S2 — CID 66801551
5-fluoro-N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-3-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 66801551) has the molecular formula C25H27F2N3O3S2 and a molecular weight of 519.64 g/mol. Its IUPAC name is 5-fluoro-N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-3-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-fluoro-N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-3-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66801551 |
| Molecular Formula | C25H27F2N3O3S2 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 5-fluoro-N-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-3-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCCN2CCC(c3noc4cc(F)ccc34)CC2)sc2ccc(F)cc12 |
| InChI | InChI=1S/C25H27F2N3O3S2/c1-16-21-14-18(26)5-7-23(21)34-25(16)35(31,32)28-10-2-3-11-30-12-8-17(9-13-30)24-20-6-4-19(27)15-22(20)33-29-24/h4-7,14-15,17,28H,2-3,8-13H2,1H3 |
| InChIKey | GCGNPPCFOWHEEJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|