C17H30O4 — CID 66806746
tert-butyl [(2S,3S,5S)-2-[(Z)-hept-4-enyl]-5-methyloxolan-3-yl] carbonate (PubChem CID 66806746) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is tert-butyl [(2S,3S,5S)-2-[(Z)-hept-4-enyl]-5-methyloxolan-3-yl] carbonate.
| Compound Name | tert-butyl [(2S,3S,5S)-2-[(Z)-hept-4-enyl]-5-methyloxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 66806746 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl [(2S,3S,5S)-2-[(Z)-hept-4-enyl]-5-methyloxolan-3-yl] carbonate |
| SMILES | CC/C=C\CCC[C@@H]1O[C@@H](C)C[C@@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30O4/c1-6-7-8-9-10-11-14-15(12-13(2)19-14)20-16(18)21-17(3,4)5/h7-8,13-15H,6,9-12H2,1-5H3/b8-7-/t13-,14-,15-/m0/s1 |
| InChIKey | GVYRTGINCFFMKI-RTJHIJBXSA-N |
| XLogP | 4.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|