C23H36N2 — CID 66808688
1,2-bis(1-adamantyl)imidazolidine (PubChem CID 66808688) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 1,2-bis(1-adamantyl)imidazolidine.
| Compound Name | 1,2-bis(1-adamantyl)imidazolidine |
|---|---|
| PubChem CID | 66808688 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 1,2-bis(1-adamantyl)imidazolidine |
| SMILES | C1CN(C23CC4CC(CC(C4)C2)C3)C(C23CC4CC(CC(C4)C2)C3)N1 |
| InChI | InChI=1S/C23H36N2/c1-2-25(23-12-18-6-19(13-23)8-20(7-18)14-23)21(24-1)22-9-15-3-16(10-22)5-17(4-15)11-22/h15-21,24H,1-14H2 |
| InChIKey | SCEFEWSMCHTMLV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |