C19H25F3O — CID 66809625
1-(4-propylcyclohexyl)-4-[[(Z)-3,3,3-trifluoroprop-1-enoxy]methyl]benzene (PubChem CID 66809625) has the molecular formula C19H25F3O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(4-propylcyclohexyl)-4-[[(Z)-3,3,3-trifluoroprop-1-enoxy]methyl]benzene.
| Compound Name | 1-(4-propylcyclohexyl)-4-[[(Z)-3,3,3-trifluoroprop-1-enoxy]methyl]benzene |
|---|---|
| PubChem CID | 66809625 |
| Molecular Formula | C19H25F3O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-(4-propylcyclohexyl)-4-[[(Z)-3,3,3-trifluoroprop-1-enoxy]methyl]benzene |
| SMILES | CCCC1CCC(c2ccc(CO/C=C\C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H25F3O/c1-2-3-15-4-8-17(9-5-15)18-10-6-16(7-11-18)14-23-13-12-19(20,21)22/h6-7,10-13,15,17H,2-5,8-9,14H2,1H3/b13-12- |
| InChIKey | OLJBUBIOBXGYOU-SEYXRHQNSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|