C34H38O10 — CID 66810622
benzene-1,4-diol;bis(4-(5-oxohept-6-enoxy)benzoic acid) (PubChem CID 66810622) has the molecular formula C34H38O10 and a molecular weight of 606.67 g/mol. Its IUPAC name is benzene-1,4-diol;bis(4-(5-oxohept-6-enoxy)benzoic acid).
| Compound Name | benzene-1,4-diol;bis(4-(5-oxohept-6-enoxy)benzoic acid) |
|---|---|
| PubChem CID | 66810622 |
| Molecular Formula | C34H38O10 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | benzene-1,4-diol;bis(4-(5-oxohept-6-enoxy)benzoic acid) |
| SMILES | C=CC(=O)CCCCOc1ccc(C(=O)O)cc1.C=CC(=O)CCCCOc1ccc(C(=O)O)cc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C14H16O4.C6H6O2/c2*1-2-12(15)5-3-4-10-18-13-8-6-11(7-9-13)14(16)17;7-5-1-2-6(8)4-3-5/h2*2,6-9H,1,3-5,10H2,(H,16,17);1-4,7-8H |
| InChIKey | CMMIYVJBEIMUGK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|