C30H32N10 — CID 66813019
1-phenyl-2-(N'-phenylcarbamimidoyl)-1-[2-(N-[N'-(N'-phenylcarbamimidoyl)carbamimidoyl]anilino)ethyl]guanidine (PubChem CID 66813019) has the molecular formula C30H32N10 and a molecular weight of 532.66 g/mol. Its IUPAC name is 1-phenyl-2-(N'-phenylcarbamimidoyl)-1-[2-(N-[N'-(N'-phenylcarbamimidoyl)carbamimidoyl]anilino)ethyl]guanidine.
| Compound Name | 1-phenyl-2-(N'-phenylcarbamimidoyl)-1-[2-(N-[N'-(N'-phenylcarbamimidoyl)carbamimidoyl]anilino)ethyl]guanidine |
|---|---|
| PubChem CID | 66813019 |
| Molecular Formula | C30H32N10 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 1-phenyl-2-(N'-phenylcarbamimidoyl)-1-[2-(N-[N'-(N'-phenylcarbamimidoyl)carbamimidoyl]anilino)ethyl]guanidine |
| SMILES | NC(=N/C(N)=N/c1ccccc1)N(CCN(C(N)=N/C(N)=N/c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N10/c31-27(35-23-13-5-1-6-14-23)37-29(33)39(25-17-9-3-10-18-25)21-22-40(26-19-11-4-12-20-26)30(34)38-28(32)36-24-15-7-2-8-16-24/h1-20H,21-22H2,(H4,31,33,35,37)(H4,32,34,36,38) |
| InChIKey | VFKLCXVVJFGVNR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|