About (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate
(9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate (PubChem CID 66829173) has the molecular formula C17H17NO4
and a molecular weight of 299.33 g/mol. Its IUPAC name is (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate |
| PubChem CID | 66829173 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate |
| SMILES | COc1ccc2c(c1)CCn1c-2cc(COC(C)=O)cc1=O |
| InChI | InChI=1S/C17H17NO4/c1-11(19)22-10-12-7-16-15-4-3-14(21-2)9-13(15)5-6-18(16)17(20)8-12/h3-4,7-9H,5-6,10H2,1-2H3 |
| InChIKey | GCIPSFKOFJHAIO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate?
The IUPAC name of (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate (CID 66829173) is (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate.
What is the SMILES notation for (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate?
The canonical SMILES for (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate is COc1ccc2c(c1)CCn1c-2cc(COC(C)=O)cc1=O.
What is the InChIKey of (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate?
The InChIKey is GCIPSFKOFJHAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4/c1-11(19)22-10-12-7-16-15-4-3-14(21-2)9-13(15)5-6-18(16)17(20)8-12/h3-4,7-9H,5-6,10H2,1-2H3.
What are the key properties of (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate?
(9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate has a molecular weight of 299.33 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methoxy-4-oxo-6,7-dihydrobenzo[a]quinolizin-2-yl)methyl acetate is sourced from PubChem (CID 66829173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).