C15H19ClF3NO — CID 66848683
3-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropyl]pyrrolidine (PubChem CID 66848683) has the molecular formula C15H19ClF3NO and a molecular weight of 321.77 g/mol. Its IUPAC name is 3-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropyl]pyrrolidine.
| Compound Name | 3-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 66848683 |
| Molecular Formula | C15H19ClF3NO |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[(1S)-1-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropyl]pyrrolidine |
| SMILES | CC(C)[C@H](Oc1ccc(C(F)(F)F)cc1Cl)C1CCNC1 |
| InChI | InChI=1S/C15H19ClF3NO/c1-9(2)14(10-5-6-20-8-10)21-13-4-3-11(7-12(13)16)15(17,18)19/h3-4,7,9-10,14,20H,5-6,8H2,1-2H3/t10?,14-/m0/s1 |
| InChIKey | DJCITSAZXOPCRM-SBNLOKMTSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |