C21H15ClN2O4S2 — CID 66850404
5-[3-(5-acetylthiophen-2-yl)-1H-indole-6-carbonyl]-2-chlorobenzenesulfonamide (PubChem CID 66850404) has the molecular formula C21H15ClN2O4S2 and a molecular weight of 458.95 g/mol. Its IUPAC name is 5-[3-(5-acetylthiophen-2-yl)-1H-indole-6-carbonyl]-2-chlorobenzenesulfonamide.
| Compound Name | 5-[3-(5-acetylthiophen-2-yl)-1H-indole-6-carbonyl]-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 66850404 |
| Molecular Formula | C21H15ClN2O4S2 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 5-[3-(5-acetylthiophen-2-yl)-1H-indole-6-carbonyl]-2-chlorobenzenesulfonamide |
| SMILES | CC(=O)c1ccc(-c2c[nH]c3cc(C(=O)c4ccc(Cl)c(S(N)(=O)=O)c4)ccc23)s1 |
| InChI | InChI=1S/C21H15ClN2O4S2/c1-11(25)18-6-7-19(29-18)15-10-24-17-8-12(2-4-14(15)17)21(26)13-3-5-16(22)20(9-13)30(23,27)28/h2-10,24H,1H3,(H2,23,27,28) |
| InChIKey | WPZTZUPHSXBPDW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |