C23H26FN3O4S — CID 66851086
(5R)-5-[[4-(4-fluorophenyl)piperidin-1-yl]sulfonylmethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 66851086) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is (5R)-5-[[4-(4-fluorophenyl)piperidin-1-yl]sulfonylmethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[4-(4-fluorophenyl)piperidin-1-yl]sulfonylmethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 66851086 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (5R)-5-[[4-(4-fluorophenyl)piperidin-1-yl]sulfonylmethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](CCc2ccccc2)(CS(=O)(=O)N2CCC(c3ccc(F)cc3)CC2)N1 |
| InChI | InChI=1S/C23H26FN3O4S/c24-20-8-6-18(7-9-20)19-11-14-27(15-12-19)32(30,31)16-23(21(28)25-22(29)26-23)13-10-17-4-2-1-3-5-17/h1-9,19H,10-16H2,(H2,25,26,28,29)/t23-/m0/s1 |
| InChIKey | SARAXYDYCIIOEN-QHCPKHFHSA-N |
| XLogP | 2.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|