C19H21N7O — CID 66856510
2-[[3-(3-aminopiperidin-1-yl)-1-oxo-[1,2,4]triazino[1,2-a][1,2,4]triazin-2-yl]methyl]benzonitrile (PubChem CID 66856510) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 2-[[3-(3-aminopiperidin-1-yl)-1-oxo-[1,2,4]triazino[1,2-a][1,2,4]triazin-2-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-(3-aminopiperidin-1-yl)-1-oxo-[1,2,4]triazino[1,2-a][1,2,4]triazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 66856510 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[[3-(3-aminopiperidin-1-yl)-1-oxo-[1,2,4]triazino[1,2-a][1,2,4]triazin-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)N2C=NC=CN2C=C1N1CCCC(N)C1 |
| InChI | InChI=1S/C19H21N7O/c20-10-15-4-1-2-5-16(15)11-25-18(23-8-3-6-17(21)12-23)13-24-9-7-22-14-26(24)19(25)27/h1-2,4-5,7,9,13-14,17H,3,6,8,11-12,21H2 |
| InChIKey | PEYBZQBMNXEDIY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |