C19H25N5 — CID 126639882
2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2-methylidene-4H-pyrimidin-1-yl]methyl]benzonitrile (PubChem CID 126639882) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2-methylidene-4H-pyrimidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2-methylidene-4H-pyrimidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126639882 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[[6-(3-aminopiperidin-1-yl)-3-methyl-2-methylidene-4H-pyrimidin-1-yl]methyl]benzonitrile |
| SMILES | C=C1N(C)CC=C(N2CCCC(N)C2)N1Cc1ccccc1C#N |
| InChI | InChI=1S/C19H25N5/c1-15-22(2)11-9-19(23-10-5-8-18(21)14-23)24(15)13-17-7-4-3-6-16(17)12-20/h3-4,6-7,9,18H,1,5,8,10-11,13-14,21H2,2H3 |
| InChIKey | ONXSSYKWQPROMG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |