C19H24N6O — CID 67122501
2-[[2-(3-aminopiperidin-1-yl)-4-oxo-4a,5,6,7-tetrahydropyrrolo[2,1-f][1,2,4]triazin-3-yl]methyl]benzonitrile (PubChem CID 67122501) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[[2-(3-aminopiperidin-1-yl)-4-oxo-4a,5,6,7-tetrahydropyrrolo[2,1-f][1,2,4]triazin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-(3-aminopiperidin-1-yl)-4-oxo-4a,5,6,7-tetrahydropyrrolo[2,1-f][1,2,4]triazin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 67122501 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-[[2-(3-aminopiperidin-1-yl)-4-oxo-4a,5,6,7-tetrahydropyrrolo[2,1-f][1,2,4]triazin-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)C2CCCN2N=C1N1CCCC(N)C1 |
| InChI | InChI=1S/C19H24N6O/c20-11-14-5-1-2-6-15(14)12-24-18(26)17-8-4-10-25(17)22-19(24)23-9-3-7-16(21)13-23/h1-2,5-6,16-17H,3-4,7-10,12-13,21H2 |
| InChIKey | RETJJADHIRYCEN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |