C15H19BrN2O3S — CID 66858466
3-[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl]-4,5-dimethyl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 66858466) has the molecular formula C15H19BrN2O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl]-4,5-dimethyl-1,3-thiazol-2-imine;hydrobromide.
| Compound Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl]-4,5-dimethyl-1,3-thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 66858466 |
| Molecular Formula | C15H19BrN2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 3-[2-(2,3-dihydro-1,4-benzodioxin-5-yloxy)ethyl]-4,5-dimethyl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=c1\sc(C)c(C)n1CCOc1cccc2c1OCCO2 |
| InChI | InChI=1S/C15H18N2O3S.BrH/c1-10-11(2)21-15(16)17(10)6-7-18-12-4-3-5-13-14(12)20-9-8-19-13;/h3-5,16H,6-9H2,1-2H3;1H/b16-15-; |
| InChIKey | IQFRRPVEIXUUJJ-YFKNTREVSA-N |
| XLogP | 3.07 |
| TPSA | 56.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|