C15H19FN4 — CID 66859546
6-N-[(4-fluorophenyl)methyl]-2-N-propylpyridine-2,3,6-triamine (PubChem CID 66859546) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 6-N-[(4-fluorophenyl)methyl]-2-N-propylpyridine-2,3,6-triamine.
| Compound Name | 6-N-[(4-fluorophenyl)methyl]-2-N-propylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 66859546 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 6-N-[(4-fluorophenyl)methyl]-2-N-propylpyridine-2,3,6-triamine |
| SMILES | CCCNc1nc(NCc2ccc(F)cc2)ccc1N |
| InChI | InChI=1S/C15H19FN4/c1-2-9-18-15-13(17)7-8-14(20-15)19-10-11-3-5-12(16)6-4-11/h3-8H,2,9-10,17H2,1H3,(H2,18,19,20) |
| InChIKey | HTVYWQCXUVICEF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |