C23H22Cl2F2N6O — CID 66859886
5-[5-chloro-1-(3,4-difluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 66859886) has the molecular formula C23H22Cl2F2N6O and a molecular weight of 507.37 g/mol. Its IUPAC name is 5-[5-chloro-1-(3,4-difluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-chloro-1-(3,4-difluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66859886 |
| Molecular Formula | C23H22Cl2F2N6O |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 5-[5-chloro-1-(3,4-difluorophenyl)pentyl]-N-[4-(4-chloroimidazol-1-yl)-3-methoxyphenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cc(Nc2n[nH]c(C(CCCCCl)c3ccc(F)c(F)c3)n2)ccc1-n1cnc(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2F2N6O/c1-34-20-11-15(6-8-19(20)33-12-21(25)28-13-33)29-23-30-22(31-32-23)16(4-2-3-9-24)14-5-7-17(26)18(27)10-14/h5-8,10-13,16H,2-4,9H2,1H3,(H2,29,30,31,32) |
| InChIKey | AAQLXKNRSFIUHK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|