C18H24N2O4S — CID 66863657
(2Z)-1-cyclopropyl-2-(dimethylaminomethylidene)-3-[2-methyl-3-(methylamino)-4-methylsulfonylphenyl]propane-1,3-dione (PubChem CID 66863657) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2Z)-1-cyclopropyl-2-(dimethylaminomethylidene)-3-[2-methyl-3-(methylamino)-4-methylsulfonylphenyl]propane-1,3-dione.
| Compound Name | (2Z)-1-cyclopropyl-2-(dimethylaminomethylidene)-3-[2-methyl-3-(methylamino)-4-methylsulfonylphenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 66863657 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2Z)-1-cyclopropyl-2-(dimethylaminomethylidene)-3-[2-methyl-3-(methylamino)-4-methylsulfonylphenyl]propane-1,3-dione |
| SMILES | CNc1c(S(C)(=O)=O)ccc(C(=O)/C(=C\N(C)C)C(=O)C2CC2)c1C |
| InChI | InChI=1S/C18H24N2O4S/c1-11-13(8-9-15(16(11)19-2)25(5,23)24)18(22)14(10-20(3)4)17(21)12-6-7-12/h8-10,12,19H,6-7H2,1-5H3/b14-10- |
| InChIKey | USNUNKVBVKQBNE-UVTDQMKNSA-N |
| XLogP | 2.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|