C23H25N7O3S — CID 66864090
N-(2-aminophenyl)-5-[(Z)-1-[4-(dimethylamino)anilino]-2-nitroethenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 66864090) has the molecular formula C23H25N7O3S and a molecular weight of 479.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[(Z)-1-[4-(dimethylamino)anilino]-2-nitroethenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[(Z)-1-[4-(dimethylamino)anilino]-2-nitroethenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66864090 |
| Molecular Formula | C23H25N7O3S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-(2-aminophenyl)-5-[(Z)-1-[4-(dimethylamino)anilino]-2-nitroethenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN(C)c1ccc(N/C(=C/[N+](=O)[O-])N2CCc3nc(C(=O)Nc4ccccc4N)sc3C2)cc1 |
| InChI | InChI=1S/C23H25N7O3S/c1-28(2)16-9-7-15(8-10-16)25-21(14-30(32)33)29-12-11-19-20(13-29)34-23(27-19)22(31)26-18-6-4-3-5-17(18)24/h3-10,14,25H,11-13,24H2,1-2H3,(H,26,31)/b21-14- |
| InChIKey | SBTOVABMKDHUPK-STZFKDTASA-N |
| XLogP | 3.59 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|