C22H23N5O3S2 — CID 87183312
N-(2-amino-5-methoxyphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 87183312) has the molecular formula C22H23N5O3S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87183312 |
| Molecular Formula | C22H23N5O3S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=S)N2CCc3nc(C(=O)Nc4cc(OC)ccc4N)sc3C2)cc1 |
| InChI | InChI=1S/C22H23N5O3S2/c1-29-14-5-3-13(4-6-14)24-22(31)27-10-9-17-19(12-27)32-21(26-17)20(28)25-18-11-15(30-2)7-8-16(18)23/h3-8,11H,9-10,12,23H2,1-2H3,(H,24,31)(H,25,28) |
| InChIKey | QSAZIYLACHFCDB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|