C25H28N6O4S — CID 91311953
N-(2-amino-5-propylphenyl)-5-[N-(4-methoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 91311953) has the molecular formula C25H28N6O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is N-(2-amino-5-propylphenyl)-5-[N-(4-methoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-5-propylphenyl)-5-[N-(4-methoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91311953 |
| Molecular Formula | C25H28N6O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-(2-amino-5-propylphenyl)-5-[N-(4-methoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CCCc1ccc(N)c(NC(=O)c2nc3c(s2)CN(/C(C[N+](=O)[O-])=N/c2ccc(OC)cc2)CC3)c1 |
| InChI | InChI=1S/C25H28N6O4S/c1-3-4-16-5-10-19(26)21(13-16)28-24(32)25-29-20-11-12-30(14-22(20)36-25)23(15-31(33)34)27-17-6-8-18(35-2)9-7-17/h5-10,13H,3-4,11-12,14-15,26H2,1-2H3,(H,28,32)/b27-23+ |
| InChIKey | LZAQHNXQXLEAHP-SLEBQGDGSA-N |
| XLogP | 4.30 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|