C20H25N5O4S — CID 66864107
N-(2-amino-5-methoxyphenyl)-5-[2-(butylamino)-2-oxoacetyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 66864107) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-5-[2-(butylamino)-2-oxoacetyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)-5-[2-(butylamino)-2-oxoacetyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66864107 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-5-[2-(butylamino)-2-oxoacetyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CCCCNC(=O)C(=O)N1CCc2nc(C(=O)Nc3cc(OC)ccc3N)sc2C1 |
| InChI | InChI=1S/C20H25N5O4S/c1-3-4-8-22-18(27)20(28)25-9-7-14-16(11-25)30-19(24-14)17(26)23-15-10-12(29-2)5-6-13(15)21/h5-6,10H,3-4,7-9,11,21H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | AFVWSIWYPZZDCV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|