C23H24N6O5S — CID 91257443
N-(2-aminophenyl)-5-[N-(3,4-dimethoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 91257443) has the molecular formula C23H24N6O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[N-(3,4-dimethoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[N-(3,4-dimethoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91257443 |
| Molecular Formula | C23H24N6O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-(2-aminophenyl)-5-[N-(3,4-dimethoxyphenyl)-C-(nitromethyl)carbonimidoyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | COc1ccc(/N=C(\C[N+](=O)[O-])N2CCc3nc(C(=O)Nc4ccccc4N)sc3C2)cc1OC |
| InChI | InChI=1S/C23H24N6O5S/c1-33-18-8-7-14(11-19(18)34-2)25-21(13-29(31)32)28-10-9-17-20(12-28)35-23(27-17)22(30)26-16-6-4-3-5-15(16)24/h3-8,11H,9-10,12-13,24H2,1-2H3,(H,26,30)/b25-21+ |
| InChIKey | XOQOELZZJAWFFB-NJNXFGOHSA-N |
| XLogP | 3.36 |
| TPSA | 145.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|