C24H27N5O2S2 — CID 87183151
N-(2-amino-5-propan-2-ylphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 87183151) has the molecular formula C24H27N5O2S2 and a molecular weight of 481.65 g/mol. Its IUPAC name is N-(2-amino-5-propan-2-ylphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-5-propan-2-ylphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87183151 |
| Molecular Formula | C24H27N5O2S2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-(2-amino-5-propan-2-ylphenyl)-5-[(4-methoxyphenyl)carbamothioyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=S)N2CCc3nc(C(=O)Nc4cc(C(C)C)ccc4N)sc3C2)cc1 |
| InChI | InChI=1S/C24H27N5O2S2/c1-14(2)15-4-9-18(25)20(12-15)27-22(30)23-28-19-10-11-29(13-21(19)33-23)24(32)26-16-5-7-17(31-3)8-6-16/h4-9,12,14H,10-11,13,25H2,1-3H3,(H,26,32)(H,27,30) |
| InChIKey | DHZRZRLSFROCFH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|