C32H20N2S4 — CID 66867019
2,9-bis[2-(5-thiophen-2-ylthiophen-2-yl)ethenyl]-1,10-phenanthroline (PubChem CID 66867019) has the molecular formula C32H20N2S4 and a molecular weight of 560.79 g/mol. Its IUPAC name is 2,9-bis[2-(5-thiophen-2-ylthiophen-2-yl)ethenyl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[2-(5-thiophen-2-ylthiophen-2-yl)ethenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 66867019 |
| Molecular Formula | C32H20N2S4 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 2,9-bis[2-(5-thiophen-2-ylthiophen-2-yl)ethenyl]-1,10-phenanthroline |
| SMILES | C(=Cc1ccc(-c2cccs2)s1)c1ccc2ccc3ccc(C=Cc4ccc(-c5cccs5)s4)nc3c2n1 |
| InChI | InChI=1S/C32H20N2S4/c1-3-27(35-19-1)29-17-15-25(37-29)13-11-23-9-7-21-5-6-22-8-10-24(34-32(22)31(21)33-23)12-14-26-16-18-30(38-26)28-4-2-20-36-28/h1-20H |
| InChIKey | VIWAZDGJXLJXET-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|