C19H30N4O4S2 — CID 66872366
ethyl 2-[[5-[[(4-methylcyclohexyl)-(oxan-4-yl)carbamoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 66872366) has the molecular formula C19H30N4O4S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is ethyl 2-[[5-[[(4-methylcyclohexyl)-(oxan-4-yl)carbamoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[(4-methylcyclohexyl)-(oxan-4-yl)carbamoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 66872366 |
| Molecular Formula | C19H30N4O4S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 2-[[5-[[(4-methylcyclohexyl)-(oxan-4-yl)carbamoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)N(C2CCOCC2)C2CCC(C)CC2)s1 |
| InChI | InChI=1S/C19H30N4O4S2/c1-3-27-16(24)12-28-19-22-21-17(29-19)20-18(25)23(15-8-10-26-11-9-15)14-6-4-13(2)5-7-14/h13-15H,3-12H2,1-2H3,(H,20,21,25) |
| InChIKey | ZYJRZWMLLHKDQH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|