C24H23ClFN5O — CID 66881903
N-[2-(3-chlorophenyl)ethyl]-4-(6-fluoroindol-1-yl)-6-morpholin-4-ylpyrimidin-2-amine (PubChem CID 66881903) has the molecular formula C24H23ClFN5O and a molecular weight of 451.93 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4-(6-fluoroindol-1-yl)-6-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4-(6-fluoroindol-1-yl)-6-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 66881903 |
| Molecular Formula | C24H23ClFN5O |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4-(6-fluoroindol-1-yl)-6-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Fc1ccc2ccn(-c3cc(N4CCOCC4)nc(NCCc4cccc(Cl)c4)n3)c2c1 |
| InChI | InChI=1S/C24H23ClFN5O/c25-19-3-1-2-17(14-19)6-8-27-24-28-22(30-10-12-32-13-11-30)16-23(29-24)31-9-7-18-4-5-20(26)15-21(18)31/h1-5,7,9,14-16H,6,8,10-13H2,(H,27,28,29) |
| InChIKey | UYLVHITYLTUQOM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |