C34H49N7O4Si — CID 66893522
8-[1-[(5-oxopyrrolidin-3-yl)-(4-propan-2-ylphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 66893522) has the molecular formula C34H49N7O4Si and a molecular weight of 647.90 g/mol. Its IUPAC name is 8-[1-[(5-oxopyrrolidin-3-yl)-(4-propan-2-ylphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-[1-[(5-oxopyrrolidin-3-yl)-(4-propan-2-ylphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66893522 |
| Molecular Formula | C34H49N7O4Si |
| Molecular Weight | 647.90 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | 8-[1-[(5-oxopyrrolidin-3-yl)-(4-propan-2-ylphenyl)methyl]pyrazol-4-yl]-1,3-dipropyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(-c3cnn(C(c4ccc(C(C)C)cc4)C4CNC(=O)C4)c3)n2COCC[Si](C)(C)C)n(CCC)c1=O |
| InChI | InChI=1S/C34H49N7O4Si/c1-8-14-38-32-30(33(43)39(15-9-2)34(38)44)40(22-45-16-17-46(5,6)7)31(37-32)27-20-36-41(21-27)29(26-18-28(42)35-19-26)25-12-10-24(11-13-25)23(3)4/h10-13,20-21,23,26,29H,8-9,14-19,22H2,1-7H3,(H,35,42) |
| InChIKey | DGGFQKLNHOOKQQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|