C19H24N4O2 — CID 66893972
N',N'-bis(2-aminophenyl)heptanediamide (PubChem CID 66893972) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N',N'-bis(2-aminophenyl)heptanediamide.
| Compound Name | N',N'-bis(2-aminophenyl)heptanediamide |
|---|---|
| PubChem CID | 66893972 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N',N'-bis(2-aminophenyl)heptanediamide |
| SMILES | NC(=O)CCCCCC(=O)N(c1ccccc1N)c1ccccc1N |
| InChI | InChI=1S/C19H24N4O2/c20-14-8-4-6-10-16(14)23(17-11-7-5-9-15(17)21)19(25)13-3-1-2-12-18(22)24/h4-11H,1-3,12-13,20-21H2,(H2,22,24) |
| InChIKey | KJPZSZXGBIAFEF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|