C14H11ClF3N3O3 — CID 66897254
N-[(1R)-1-[4-chloro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 66897254) has the molecular formula C14H11ClF3N3O3 and a molecular weight of 361.71 g/mol. Its IUPAC name is N-[(1R)-1-[4-chloro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(1R)-1-[4-chloro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 66897254 |
| Molecular Formula | C14H11ClF3N3O3 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-[(1R)-1-[4-chloro-3-(trifluoromethyl)phenyl]ethyl]-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc([N+](=O)[O-])c[nH]1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11ClF3N3O3/c1-7(8-2-3-11(15)10(4-8)14(16,17)18)20-13(22)12-5-9(6-19-12)21(23)24/h2-7,19H,1H3,(H,20,22)/t7-/m1/s1 |
| InChIKey | QJFXHGVTBHLJIV-SSDOTTSWSA-N |
| XLogP | 4.09 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|