C25H34N4O5S — CID 66900621
tert-butyl-[5-[[2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl]oxy]pentyl]carbamic acid (PubChem CID 66900621) has the molecular formula C25H34N4O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is tert-butyl-[5-[[2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl]oxy]pentyl]carbamic acid.
| Compound Name | tert-butyl-[5-[[2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl]oxy]pentyl]carbamic acid |
|---|---|
| PubChem CID | 66900621 |
| Molecular Formula | C25H34N4O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | tert-butyl-[5-[[2-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]-3H-benzimidazol-5-yl]oxy]pentyl]carbamic acid |
| SMILES | COc1ccnc(CSc2nc3ccc(OCCCCCN(C(=O)O)C(C)(C)C)cc3[nH]2)c1OC |
| InChI | InChI=1S/C25H34N4O5S/c1-25(2,3)29(24(30)31)13-7-6-8-14-34-17-9-10-18-19(15-17)28-23(27-18)35-16-20-22(33-5)21(32-4)11-12-26-20/h9-12,15H,6-8,13-14,16H2,1-5H3,(H,27,28)(H,30,31) |
| InChIKey | ZKJJQUKKVMSXQI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|