C23H20Cl2N2O4S — CID 66908919
2-[(5-cyanonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid (PubChem CID 66908919) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is 2-[(5-cyanonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid.
| Compound Name | 2-[(5-cyanonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 66908919 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 2-[(5-cyanonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(c1cccc2c(C#N)cccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4S/c1-2-3-9-22(23(28)29)27(32(30,31)18-12-16(24)11-17(25)13-18)21-10-5-7-19-15(14-26)6-4-8-20(19)21/h4-8,10-13,22H,2-3,9H2,1H3,(H,28,29) |
| InChIKey | DPIKGLIIHZHRDS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |