C24H24Cl2N2O5S — CID 66991199
2-[(2-acetamidonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid (PubChem CID 66991199) has the molecular formula C24H24Cl2N2O5S and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-[(2-acetamidonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid.
| Compound Name | 2-[(2-acetamidonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 66991199 |
| Molecular Formula | C24H24Cl2N2O5S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 2-[(2-acetamidonaphthalen-1-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(c1c(NC(C)=O)ccc2ccccc12)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2N2O5S/c1-3-4-9-22(24(30)31)28(34(32,33)19-13-17(25)12-18(26)14-19)23-20-8-6-5-7-16(20)10-11-21(23)27-15(2)29/h5-8,10-14,22H,3-4,9H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | WSTMKAYOQSQLAG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |