C23H22Cl2N2O5S — CID 66908938
2-[(6-carbamoylnaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid (PubChem CID 66908938) has the molecular formula C23H22Cl2N2O5S and a molecular weight of 509.41 g/mol. Its IUPAC name is 2-[(6-carbamoylnaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid.
| Compound Name | 2-[(6-carbamoylnaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 66908938 |
| Molecular Formula | C23H22Cl2N2O5S |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 2-[(6-carbamoylnaphthalen-2-yl)-(3,5-dichlorophenyl)sulfonylamino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(c1ccc2cc(C(N)=O)ccc2c1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H22Cl2N2O5S/c1-2-3-4-21(23(29)30)27(33(31,32)20-12-17(24)11-18(25)13-20)19-8-7-14-9-16(22(26)28)6-5-15(14)10-19/h5-13,21H,2-4H2,1H3,(H2,26,28)(H,29,30) |
| InChIKey | YUISWWZUPIIKER-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |