C11H14N2O2Si — CID 66917597
[6-(2-trimethylsilylethynyl)-3-pyridinyl]carbamic acid (PubChem CID 66917597) has the molecular formula C11H14N2O2Si and a molecular weight of 234.33 g/mol. Its IUPAC name is [6-(2-trimethylsilylethynyl)-3-pyridinyl]carbamic acid.
| Compound Name | [6-(2-trimethylsilylethynyl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 66917597 |
| Molecular Formula | C11H14N2O2Si |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | [6-(2-trimethylsilylethynyl)-3-pyridinyl]carbamic acid |
| SMILES | C[Si](C)(C)C#Cc1ccc(NC(=O)O)cn1 |
| InChI | InChI=1S/C11H14N2O2Si/c1-16(2,3)7-6-9-4-5-10(8-12-9)13-11(14)15/h4-5,8,13H,1-3H3,(H,14,15) |
| InChIKey | RUHZZFNVAYLIGZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|