C21H28N4O2Si — CID 167328925
tert-butyl N-[4-[[[5-(2-trimethylsilylethynyl)pyrazin-2-yl]amino]methyl]phenyl]carbamate (PubChem CID 167328925) has the molecular formula C21H28N4O2Si and a molecular weight of 396.57 g/mol. Its IUPAC name is tert-butyl N-[4-[[[5-(2-trimethylsilylethynyl)pyrazin-2-yl]amino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[5-(2-trimethylsilylethynyl)pyrazin-2-yl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 167328925 |
| Molecular Formula | C21H28N4O2Si |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl N-[4-[[[5-(2-trimethylsilylethynyl)pyrazin-2-yl]amino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNc2cnc(C#C[Si](C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C21H28N4O2Si/c1-21(2,3)27-20(26)25-17-9-7-16(8-10-17)13-23-19-15-22-18(14-24-19)11-12-28(4,5)6/h7-10,14-15H,13H2,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | PEDKLFYGDNPCPC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|