C28H38N4O4 — CID 66919334
tert-butyl N-[2-[6-[1-(oxan-2-yl)-4-propoxyindazol-5-yl]-3-pyridinyl]propyl]carbamate (PubChem CID 66919334) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is tert-butyl N-[2-[6-[1-(oxan-2-yl)-4-propoxyindazol-5-yl]-3-pyridinyl]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-[1-(oxan-2-yl)-4-propoxyindazol-5-yl]-3-pyridinyl]propyl]carbamate |
|---|---|
| PubChem CID | 66919334 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | tert-butyl N-[2-[6-[1-(oxan-2-yl)-4-propoxyindazol-5-yl]-3-pyridinyl]propyl]carbamate |
| SMILES | CCCOc1c(-c2ccc(C(C)CNC(=O)OC(C)(C)C)cn2)ccc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C28H38N4O4/c1-6-14-35-26-21(11-13-24-22(26)18-31-32(24)25-9-7-8-15-34-25)23-12-10-20(17-29-23)19(2)16-30-27(33)36-28(3,4)5/h10-13,17-19,25H,6-9,14-16H2,1-5H3,(H,30,33) |
| InChIKey | FXNDXPUGLOCMLO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |