C17H18N2O2S2 — CID 66924968
N-methyl-1-(4-methyl-5-phenyl-1-thiophen-3-ylsulfonylpyrrol-3-yl)methanamine (PubChem CID 66924968) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-5-phenyl-1-thiophen-3-ylsulfonylpyrrol-3-yl)methanamine.
| Compound Name | N-methyl-1-(4-methyl-5-phenyl-1-thiophen-3-ylsulfonylpyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 66924968 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-methyl-1-(4-methyl-5-phenyl-1-thiophen-3-ylsulfonylpyrrol-3-yl)methanamine |
| SMILES | CNCc1cn(S(=O)(=O)c2ccsc2)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C17H18N2O2S2/c1-13-15(10-18-2)11-19(17(13)14-6-4-3-5-7-14)23(20,21)16-8-9-22-12-16/h3-9,11-12,18H,10H2,1-2H3 |
| InChIKey | DQSUGCWVCBOXSN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |