C23H25N7O3 — CID 66929611
6-[3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazole-1-carbonyl]-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 66929611) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is 6-[3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazole-1-carbonyl]-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazole-1-carbonyl]-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 66929611 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 6-[3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazole-1-carbonyl]-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(=O)n3nc(N)nc3Nc3ccc(N4CCCC4)cc3)cc2NC1=O |
| InChI | InChI=1S/C23H25N7O3/c1-23(2)20(32)26-17-13-14(5-10-18(17)33-23)19(31)30-22(27-21(24)28-30)25-15-6-8-16(9-7-15)29-11-3-4-12-29/h5-10,13H,3-4,11-12H2,1-2H3,(H,26,32)(H3,24,25,27,28) |
| InChIKey | YQOVAFPCUUXLBG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|