C20H22N6O — CID 66929941
[3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazol-1-yl]-(4-methylphenyl)methanone (PubChem CID 66929941) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazol-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazol-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 66929941 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [3-amino-5-(4-pyrrolidin-1-ylanilino)-1,2,4-triazol-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)n2nc(N)nc2Nc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C20H22N6O/c1-14-4-6-15(7-5-14)18(27)26-20(23-19(21)24-26)22-16-8-10-17(11-9-16)25-12-2-3-13-25/h4-11H,2-3,12-13H2,1H3,(H3,21,22,23,24) |
| InChIKey | OICLITBWVGAWMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|