C27H36O3 — CID 66940769
2-[4-(cyclopropylmethoxy)-3-(2-propan-2-ylphenyl)phenyl]-2-ethyl-4-methylpentanoic acid (PubChem CID 66940769) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 2-[4-(cyclopropylmethoxy)-3-(2-propan-2-ylphenyl)phenyl]-2-ethyl-4-methylpentanoic acid.
| Compound Name | 2-[4-(cyclopropylmethoxy)-3-(2-propan-2-ylphenyl)phenyl]-2-ethyl-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66940769 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 2-[4-(cyclopropylmethoxy)-3-(2-propan-2-ylphenyl)phenyl]-2-ethyl-4-methylpentanoic acid |
| SMILES | CCC(CC(C)C)(C(=O)O)c1ccc(OCC2CC2)c(-c2ccccc2C(C)C)c1 |
| InChI | InChI=1S/C27H36O3/c1-6-27(26(28)29,16-18(2)3)21-13-14-25(30-17-20-11-12-20)24(15-21)23-10-8-7-9-22(23)19(4)5/h7-10,13-15,18-20H,6,11-12,16-17H2,1-5H3,(H,28,29) |
| InChIKey | UEVKIQMQHVALLX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |