C31H47NO10 — CID 66947036
(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)hexanoic acid (PubChem CID 66947036) has the molecular formula C31H47NO10 and a molecular weight of 593.71 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66947036 |
| Molecular Formula | C31H47NO10 |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)hexanoic acid |
| SMILES | CC(CC(c1ccc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c1)[C@H](N)C(=O)O)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C31H47NO10/c1-19(40-27(35)20-11-9-8-10-12-20)15-22(25(32)26(33)34)21-13-14-23(41-28(36)38-17-30(2,3)4)24(16-21)42-29(37)39-18-31(5,6)7/h13-14,16,19-20,22,25H,8-12,15,17-18,32H2,1-7H3,(H,33,34)/t19?,22?,25-/m0/s1 |
| InChIKey | WFQJJIZJMSZASE-KRFYGZOHSA-N |
| XLogP | 6.21 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|