C32H49NO8 — CID 66950886
(2S)-2-amino-3-[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid (PubChem CID 66950886) has the molecular formula C32H49NO8 and a molecular weight of 575.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66950886 |
| Molecular Formula | C32H49NO8 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid |
| SMILES | CC(OC(=O)C1CCCCC1)C(C)C(c1ccc(OC(=O)CC(C)(C)C)c(OC(=O)CC(C)(C)C)c1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C32H49NO8/c1-19(20(2)39-30(38)21-12-10-9-11-13-21)27(28(33)29(36)37)22-14-15-23(40-25(34)17-31(3,4)5)24(16-22)41-26(35)18-32(6,7)8/h14-16,19-21,27-28H,9-13,17-18,33H2,1-8H3,(H,36,37)/t19?,20?,27?,28-/m0/s1 |
| InChIKey | PQTXTWRXDKFVHO-BKEMKCNFSA-N |
| XLogP | 6.01 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|