C32H49NO10 — CID 66951082
(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid (PubChem CID 66951082) has the molecular formula C32H49NO10 and a molecular weight of 607.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66951082 |
| Molecular Formula | C32H49NO10 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-5-(cyclohexanecarbonyloxy)-4-methylhexanoic acid |
| SMILES | CC(C)C(C)OC(=O)Oc1ccc(C(C(C)C(C)OC(=O)C2CCCCC2)[C@H](N)C(=O)O)cc1OC(=O)OC(C)C(C)C |
| InChI | InChI=1S/C32H49NO10/c1-17(2)20(6)40-31(37)42-25-15-14-24(16-26(25)43-32(38)41-21(7)18(3)4)27(28(33)29(34)35)19(5)22(8)39-30(36)23-12-10-9-11-13-23/h14-23,27-28H,9-13,33H2,1-8H3,(H,34,35)/t19?,20?,21?,22?,27?,28-/m0/s1 |
| InChIKey | ULWIBVUZKMIMRI-AIJFUPJLSA-N |
| XLogP | 6.45 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|