C27H28N4O3 — CID 66954855
3-(3,4-dimethylindol-1-yl)-N-[[3-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylideneamino]propanamide (PubChem CID 66954855) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-(3,4-dimethylindol-1-yl)-N-[[3-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylideneamino]propanamide.
| Compound Name | 3-(3,4-dimethylindol-1-yl)-N-[[3-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 66954855 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 3-(3,4-dimethylindol-1-yl)-N-[[3-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylideneamino]propanamide |
| SMILES | COc1cc(C=NNC(=O)CCn2cc(C)c3c(C)cccc32)ccc1OCc1ccccn1 |
| InChI | InChI=1S/C27H28N4O3/c1-19-7-6-9-23-27(19)20(2)17-31(23)14-12-26(32)30-29-16-21-10-11-24(25(15-21)33-3)34-18-22-8-4-5-13-28-22/h4-11,13,15-17H,12,14,18H2,1-3H3,(H,30,32) |
| InChIKey | FAEYHKQWPWAMSA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|