C14H10ClNO3 — CID 669588
N-(4-chlorophenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 669588) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 669588 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-(4-chlorophenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10ClNO3/c15-10-2-4-11(5-3-10)16-14(17)9-1-6-12-13(7-9)19-8-18-12/h1-7H,8H2,(H,16,17) |
| InChIKey | FDFPTRMBOYUKQW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |