About N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine
N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine (PubChem CID 66959667) has the molecular formula C21H26N6
and a molecular weight of 362.48 g/mol. Its IUPAC name is N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine |
| PubChem CID | 66959667 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine |
| SMILES | CN1C=Nc2cc(-c3ccc(N4CCCCC4)nc3)nc(NC3CC3)c2C1 |
| InChI | InChI=1S/C21H26N6/c1-26-13-17-19(23-14-26)11-18(25-21(17)24-16-6-7-16)15-5-8-20(22-12-15)27-9-3-2-4-10-27/h5,8,11-12,14,16H,2-4,6-7,9-10,13H2,1H3,(H,24,25) |
| InChIKey | KWOROEABHUDKCW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine?
The IUPAC name of N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine (CID 66959667) is N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine.
What is the SMILES notation for N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine?
The canonical SMILES for N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine is CN1C=Nc2cc(-c3ccc(N4CCCCC4)nc3)nc(NC3CC3)c2C1.
What is the InChIKey of N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine?
The InChIKey is KWOROEABHUDKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N6/c1-26-13-17-19(23-14-26)11-18(25-21(17)24-16-6-7-16)15-5-8-20(22-12-15)27-9-3-2-4-10-27/h5,8,11-12,14,16H,2-4,6-7,9-10,13H2,1H3,(H,24,25).
What are the key properties of N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine?
N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine has a molecular weight of 362.48 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-methyl-7-(6-piperidin-1-yl-3-pyridinyl)-4H-pyrido[4,3-d]pyrimidin-5-amine is sourced from PubChem (CID 66959667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).