C20H29N3O2 — CID 66960718
1-methyl-6-[3-(2-piperidin-1-ylethylamino)propoxy]quinolin-2-one (PubChem CID 66960718) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-methyl-6-[3-(2-piperidin-1-ylethylamino)propoxy]quinolin-2-one.
| Compound Name | 1-methyl-6-[3-(2-piperidin-1-ylethylamino)propoxy]quinolin-2-one |
|---|---|
| PubChem CID | 66960718 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-methyl-6-[3-(2-piperidin-1-ylethylamino)propoxy]quinolin-2-one |
| SMILES | Cn1c(=O)ccc2cc(OCCCNCCN3CCCCC3)ccc21 |
| InChI | InChI=1S/C20H29N3O2/c1-22-19-8-7-18(16-17(19)6-9-20(22)24)25-15-5-10-21-11-14-23-12-3-2-4-13-23/h6-9,16,21H,2-5,10-15H2,1H3 |
| InChIKey | BSRLUBXHZGGEAC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|