C20H23N3O2 — CID 66961029
1-methyl-6-[3-(2-pyridin-2-ylethylamino)propoxy]quinolin-2-one (PubChem CID 66961029) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-methyl-6-[3-(2-pyridin-2-ylethylamino)propoxy]quinolin-2-one.
| Compound Name | 1-methyl-6-[3-(2-pyridin-2-ylethylamino)propoxy]quinolin-2-one |
|---|---|
| PubChem CID | 66961029 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-methyl-6-[3-(2-pyridin-2-ylethylamino)propoxy]quinolin-2-one |
| SMILES | Cn1c(=O)ccc2cc(OCCCNCCc3ccccn3)ccc21 |
| InChI | InChI=1S/C20H23N3O2/c1-23-19-8-7-18(15-16(19)6-9-20(23)24)25-14-4-11-21-13-10-17-5-2-3-12-22-17/h2-3,5-9,12,15,21H,4,10-11,13-14H2,1H3 |
| InChIKey | YBUAFJARGOYTSC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|