C22H29Cl2N3O2 — CID 66960568
1-methyl-6-[5-(2-pyridin-3-ylethylamino)pentoxy]quinolin-2-one;dihydrochloride (PubChem CID 66960568) has the molecular formula C22H29Cl2N3O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is 1-methyl-6-[5-(2-pyridin-3-ylethylamino)pentoxy]quinolin-2-one;dihydrochloride.
| Compound Name | 1-methyl-6-[5-(2-pyridin-3-ylethylamino)pentoxy]quinolin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 66960568 |
| Molecular Formula | C22H29Cl2N3O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 1-methyl-6-[5-(2-pyridin-3-ylethylamino)pentoxy]quinolin-2-one;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)ccc2cc(OCCCCCNCCc3cccnc3)ccc21 |
| InChI | InChI=1S/C22H27N3O2.2ClH/c1-25-21-9-8-20(16-19(21)7-10-22(25)26)27-15-4-2-3-12-23-14-11-18-6-5-13-24-17-18;;/h5-10,13,16-17,23H,2-4,11-12,14-15H2,1H3;2*1H |
| InChIKey | OHUADICZLZLDKQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|